About thiolan-1-ium;trifluoromethanesulfonate
thiolan-1-ium;trifluoromethanesulfonate (PubChem CID 21257914) has the molecular formula C5H9F3O3S2
and a molecular weight of 238.25 g/mol. Its IUPAC name is thiolan-1-ium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | thiolan-1-ium;trifluoromethanesulfonate |
| PubChem CID | 21257914 |
| Molecular Formula | C5H9F3O3S2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | thiolan-1-ium;trifluoromethanesulfonate |
| SMILES | C1CC[SH+]C1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C4H8S.CHF3O3S/c1-2-4-5-3-1;2-1(3,4)8(5,6)7/h1-4H2;(H,5,6,7) |
| InChIKey | UWIVZLWKBOZJFG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze thiolan-1-ium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiolan-1-ium;trifluoromethanesulfonate?
The IUPAC name of thiolan-1-ium;trifluoromethanesulfonate (CID 21257914) is thiolan-1-ium;trifluoromethanesulfonate.
What is the SMILES notation for thiolan-1-ium;trifluoromethanesulfonate?
The canonical SMILES for thiolan-1-ium;trifluoromethanesulfonate is C1CC[SH+]C1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of thiolan-1-ium;trifluoromethanesulfonate?
The InChIKey is UWIVZLWKBOZJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8S.CHF3O3S/c1-2-4-5-3-1;2-1(3,4)8(5,6)7/h1-4H2;(H,5,6,7).
What are the key properties of thiolan-1-ium;trifluoromethanesulfonate?
thiolan-1-ium;trifluoromethanesulfonate has a molecular weight of 238.25 g/mol, XLogP of 0.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiolan-1-ium;trifluoromethanesulfonate is sourced from PubChem (CID 21257914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).