C8H9F9O3S2 — CID 22235141
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;thiolan-1-ium (PubChem CID 22235141) has the molecular formula C8H9F9O3S2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;thiolan-1-ium.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;thiolan-1-ium |
|---|---|
| PubChem CID | 22235141 |
| Molecular Formula | C8H9F9O3S2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;thiolan-1-ium |
| SMILES | C1CC[SH+]C1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF9O3S.C4H8S/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;1-2-4-5-3-1/h(H,14,15,16);1-4H2 |
| InChIKey | SZZCAIFFTWMNTK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|