C16H32O4 — CID 21258716
2-[1-(2,3,3-trimethylpentan-2-ylperoxy)ethyl]hexanoic acid (PubChem CID 21258716) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-[1-(2,3,3-trimethylpentan-2-ylperoxy)ethyl]hexanoic acid.
| Compound Name | 2-[1-(2,3,3-trimethylpentan-2-ylperoxy)ethyl]hexanoic acid |
|---|---|
| PubChem CID | 21258716 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2-[1-(2,3,3-trimethylpentan-2-ylperoxy)ethyl]hexanoic acid |
| SMILES | CCCCC(C(=O)O)C(C)OOC(C)(C)C(C)(C)CC |
| InChI | InChI=1S/C16H32O4/c1-8-10-11-13(14(17)18)12(3)19-20-16(6,7)15(4,5)9-2/h12-13H,8-11H2,1-7H3,(H,17,18) |
| InChIKey | YBVXXBWOJUVNAO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|