C22H14N2O4 — CID 21259147
2-(4-carboxy-2-pyridinyl)-3-naphthalen-2-ylpyridine-4-carboxylic acid (PubChem CID 21259147) has the molecular formula C22H14N2O4 and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-(4-carboxy-2-pyridinyl)-3-naphthalen-2-ylpyridine-4-carboxylic acid.
| Compound Name | 2-(4-carboxy-2-pyridinyl)-3-naphthalen-2-ylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 21259147 |
| Molecular Formula | C22H14N2O4 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-(4-carboxy-2-pyridinyl)-3-naphthalen-2-ylpyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(-c2nccc(C(=O)O)c2-c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C22H14N2O4/c25-21(26)16-7-9-23-18(12-16)20-19(17(22(27)28)8-10-24-20)15-6-5-13-3-1-2-4-14(13)11-15/h1-12H,(H,25,26)(H,27,28) |
| InChIKey | AXEOIDINBRHHKM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |