C22H29NO2 — CID 21260460
4-[4-[(3-hydroxy-3-phenylpropyl)-methylamino]cyclohexyl]phenol (PubChem CID 21260460) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-[4-[(3-hydroxy-3-phenylpropyl)-methylamino]cyclohexyl]phenol.
| Compound Name | 4-[4-[(3-hydroxy-3-phenylpropyl)-methylamino]cyclohexyl]phenol |
|---|---|
| PubChem CID | 21260460 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 4-[4-[(3-hydroxy-3-phenylpropyl)-methylamino]cyclohexyl]phenol |
| SMILES | CN(CCC(O)c1ccccc1)C1CCC(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C22H29NO2/c1-23(16-15-22(25)19-5-3-2-4-6-19)20-11-7-17(8-12-20)18-9-13-21(24)14-10-18/h2-6,9-10,13-14,17,20,22,24-25H,7-8,11-12,15-16H2,1H3 |
| InChIKey | PYLCRHZKVNNWBA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |