C22H32N4O — CID 72857742
3-[[1-(6-ethyl-2-methylpyrimidin-4-yl)piperidin-4-yl]-methylamino]-1-phenylpropan-1-ol (PubChem CID 72857742) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is 3-[[1-(6-ethyl-2-methylpyrimidin-4-yl)piperidin-4-yl]-methylamino]-1-phenylpropan-1-ol.
| Compound Name | 3-[[1-(6-ethyl-2-methylpyrimidin-4-yl)piperidin-4-yl]-methylamino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 72857742 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 3-[[1-(6-ethyl-2-methylpyrimidin-4-yl)piperidin-4-yl]-methylamino]-1-phenylpropan-1-ol |
| SMILES | CCc1cc(N2CCC(N(C)CCC(O)c3ccccc3)CC2)nc(C)n1 |
| InChI | InChI=1S/C22H32N4O/c1-4-19-16-22(24-17(2)23-19)26-14-10-20(11-15-26)25(3)13-12-21(27)18-8-6-5-7-9-18/h5-9,16,20-21,27H,4,10-15H2,1-3H3 |
| InChIKey | JJUMVOWFDVXMGI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |