C20H28O4 — CID 21264694
3,5-dihydroxy-6,6-bis(3-methylbut-2-enyl)-4-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one (PubChem CID 21264694) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 3,5-dihydroxy-6,6-bis(3-methylbut-2-enyl)-4-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 3,5-dihydroxy-6,6-bis(3-methylbut-2-enyl)-4-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 21264694 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 3,5-dihydroxy-6,6-bis(3-methylbut-2-enyl)-4-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC(C)=CCC1(CC=C(C)C)C(=O)C=C(O)C(C(=O)C(C)C)=C1O |
| InChI | InChI=1S/C20H28O4/c1-12(2)7-9-20(10-8-13(3)4)16(22)11-15(21)17(19(20)24)18(23)14(5)6/h7-8,11,14,21,24H,9-10H2,1-6H3 |
| InChIKey | JNTABEMNRQRZOC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|