C21H20N2O3 — CID 2126504
4-acetyl-3,5-dimethyl-N-(2-phenoxyphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 2126504) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-acetyl-3,5-dimethyl-N-(2-phenoxyphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-3,5-dimethyl-N-(2-phenoxyphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 2126504 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4-acetyl-3,5-dimethyl-N-(2-phenoxyphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)Nc2ccccc2Oc2ccccc2)c1C |
| InChI | InChI=1S/C21H20N2O3/c1-13-19(15(3)24)14(2)22-20(13)21(25)23-17-11-7-8-12-18(17)26-16-9-5-4-6-10-16/h4-12,22H,1-3H3,(H,23,25) |
| InChIKey | XBKQGYGNEGNKCW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |