C12H22N2O2-2 — CID 21266708
2,3,3-trimethylheptane diisocyanate (PubChem CID 21266708) has the molecular formula C12H22N2O2-2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2,3,3-trimethylheptane diisocyanate.
| Compound Name | 2,3,3-trimethylheptane diisocyanate |
|---|---|
| PubChem CID | 21266708 |
| Molecular Formula | C12H22N2O2-2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2,3,3-trimethylheptane diisocyanate |
| SMILES | CCCCC(C)(C)C(C)C.[N-]=C=O.[N-]=C=O |
| InChI | InChI=1S/C10H22.2CNO/c1-6-7-8-10(4,5)9(2)3;2*2-1-3/h9H,6-8H2,1-5H3;;/q;2*-1 |
| InChIKey | HEMRLZSLWOTPAM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|