C17H12F6N4O2 — CID 21267747
5-ethyl-4-[3-(trifluoromethoxy)phenoxy]-2-[4-(trifluoromethyl)imidazol-1-yl]pyrimidine (PubChem CID 21267747) has the molecular formula C17H12F6N4O2 and a molecular weight of 418.30 g/mol. Its IUPAC name is 5-ethyl-4-[3-(trifluoromethoxy)phenoxy]-2-[4-(trifluoromethyl)imidazol-1-yl]pyrimidine.
| Compound Name | 5-ethyl-4-[3-(trifluoromethoxy)phenoxy]-2-[4-(trifluoromethyl)imidazol-1-yl]pyrimidine |
|---|---|
| PubChem CID | 21267747 |
| Molecular Formula | C17H12F6N4O2 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 5-ethyl-4-[3-(trifluoromethoxy)phenoxy]-2-[4-(trifluoromethyl)imidazol-1-yl]pyrimidine |
| SMILES | CCc1cnc(-n2cnc(C(F)(F)F)c2)nc1Oc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F6N4O2/c1-2-10-7-24-15(27-8-13(25-9-27)16(18,19)20)26-14(10)28-11-4-3-5-12(6-11)29-17(21,22)23/h3-9H,2H2,1H3 |
| InChIKey | UCNOGSFTULRDOG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |