C13H17FN2O2 — CID 21268066
N'-[(4-fluorophenyl)methyl]-2,2-dimethylbutanediamide (PubChem CID 21268066) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is N'-[(4-fluorophenyl)methyl]-2,2-dimethylbutanediamide.
| Compound Name | N'-[(4-fluorophenyl)methyl]-2,2-dimethylbutanediamide |
|---|---|
| PubChem CID | 21268066 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | N'-[(4-fluorophenyl)methyl]-2,2-dimethylbutanediamide |
| SMILES | CC(C)(CC(=O)NCc1ccc(F)cc1)C(N)=O |
| InChI | InChI=1S/C13H17FN2O2/c1-13(2,12(15)18)7-11(17)16-8-9-3-5-10(14)6-4-9/h3-6H,7-8H2,1-2H3,(H2,15,18)(H,16,17) |
| InChIKey | FEPUTQXOUOWJCO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |