C15H20FNO3 — CID 43397365
2,2-diethyl-4-[(4-fluorophenyl)methylamino]-4-oxobutanoic acid (PubChem CID 43397365) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 2,2-diethyl-4-[(4-fluorophenyl)methylamino]-4-oxobutanoic acid.
| Compound Name | 2,2-diethyl-4-[(4-fluorophenyl)methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43397365 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2,2-diethyl-4-[(4-fluorophenyl)methylamino]-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)NCc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C15H20FNO3/c1-3-15(4-2,14(19)20)9-13(18)17-10-11-5-7-12(16)8-6-11/h5-8H,3-4,9-10H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | YNCFVYGMIBOOGN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |