C12H19N3O3 — CID 61285483
2,2-diethyl-4-oxo-4-(1H-pyrazol-5-ylmethylamino)butanoic acid (PubChem CID 61285483) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2,2-diethyl-4-oxo-4-(1H-pyrazol-5-ylmethylamino)butanoic acid.
| Compound Name | 2,2-diethyl-4-oxo-4-(1H-pyrazol-5-ylmethylamino)butanoic acid |
|---|---|
| PubChem CID | 61285483 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2,2-diethyl-4-oxo-4-(1H-pyrazol-5-ylmethylamino)butanoic acid |
| SMILES | CCC(CC)(CC(=O)NCc1ccn[nH]1)C(=O)O |
| InChI | InChI=1S/C12H19N3O3/c1-3-12(4-2,11(17)18)7-10(16)13-8-9-5-6-14-15-9/h5-6H,3-4,7-8H2,1-2H3,(H,13,16)(H,14,15)(H,17,18) |
| InChIKey | CHYDUXWSPZQPKR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |