C30H33N3O3 — CID 21270115
[2-[4-(diethylamino)butylcarbamoyl]-1-phenylindol-3-yl] benzoate (PubChem CID 21270115) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is [2-[4-(diethylamino)butylcarbamoyl]-1-phenylindol-3-yl] benzoate.
| Compound Name | [2-[4-(diethylamino)butylcarbamoyl]-1-phenylindol-3-yl] benzoate |
|---|---|
| PubChem CID | 21270115 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | [2-[4-(diethylamino)butylcarbamoyl]-1-phenylindol-3-yl] benzoate |
| SMILES | CCN(CC)CCCCNC(=O)c1c(OC(=O)c2ccccc2)c2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C30H33N3O3/c1-3-32(4-2)22-14-13-21-31-29(34)27-28(36-30(35)23-15-7-5-8-16-23)25-19-11-12-20-26(25)33(27)24-17-9-6-10-18-24/h5-12,15-20H,3-4,13-14,21-22H2,1-2H3,(H,31,34) |
| InChIKey | CSDRJPNMMPXGGP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|