About 1-(2-hexyldecoxy)ethanol
1-(2-hexyldecoxy)ethanol (PubChem CID 21270603) has the molecular formula C18H38O2
and a molecular weight of 286.50 g/mol. Its IUPAC name is 1-(2-hexyldecoxy)ethanol.
Molecular Properties
| Compound Name | 1-(2-hexyldecoxy)ethanol |
| PubChem CID | 21270603 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 1-(2-hexyldecoxy)ethanol |
| SMILES | CCCCCCCCC(CCCCCC)COC(C)O |
| InChI | InChI=1S/C18H38O2/c1-4-6-8-10-11-13-15-18(16-20-17(3)19)14-12-9-7-5-2/h17-19H,4-16H2,1-3H3 |
| InChIKey | CAAXACKJXOSQCR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hexyldecoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hexyldecoxy)ethanol?
The IUPAC name of 1-(2-hexyldecoxy)ethanol (CID 21270603) is 1-(2-hexyldecoxy)ethanol.
What is the SMILES notation for 1-(2-hexyldecoxy)ethanol?
The canonical SMILES for 1-(2-hexyldecoxy)ethanol is CCCCCCCCC(CCCCCC)COC(C)O.
What is the InChIKey of 1-(2-hexyldecoxy)ethanol?
The InChIKey is CAAXACKJXOSQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O2/c1-4-6-8-10-11-13-15-18(16-20-17(3)19)14-12-9-7-5-2/h17-19H,4-16H2,1-3H3.
What are the key properties of 1-(2-hexyldecoxy)ethanol?
1-(2-hexyldecoxy)ethanol has a molecular weight of 286.50 g/mol, XLogP of 5.68, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hexyldecoxy)ethanol is sourced from PubChem (CID 21270603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).