C10H17ClN2O4 — CID 21275446
2-methoxy-8-methyl-8-oxido-2-aza-8-azoniaspiro[4.5]decane-1,3-dione;hydrochloride (PubChem CID 21275446) has the molecular formula C10H17ClN2O4 and a molecular weight of 264.71 g/mol. Its IUPAC name is 2-methoxy-8-methyl-8-oxido-2-aza-8-azoniaspiro[4.5]decane-1,3-dione;hydrochloride.
| Compound Name | 2-methoxy-8-methyl-8-oxido-2-aza-8-azoniaspiro[4.5]decane-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 21275446 |
| Molecular Formula | C10H17ClN2O4 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-methoxy-8-methyl-8-oxido-2-aza-8-azoniaspiro[4.5]decane-1,3-dione;hydrochloride |
| SMILES | CON1C(=O)CC2(CC[N+](C)([O-])CC2)C1=O.Cl |
| InChI | InChI=1S/C10H16N2O4.ClH/c1-12(15)5-3-10(4-6-12)7-8(13)11(16-2)9(10)14;/h3-7H2,1-2H3;1H |
| InChIKey | CXDREEZXMOXWCC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|