C13H11Cl3F3N3OS — CID 21275610
5-cyclopropyl-2-(trichloromethylsulfanyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazolidin-3-one (PubChem CID 21275610) has the molecular formula C13H11Cl3F3N3OS and a molecular weight of 420.67 g/mol. Its IUPAC name is 5-cyclopropyl-2-(trichloromethylsulfanyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazolidin-3-one.
| Compound Name | 5-cyclopropyl-2-(trichloromethylsulfanyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 21275610 |
| Molecular Formula | C13H11Cl3F3N3OS |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | 5-cyclopropyl-2-(trichloromethylsulfanyl)-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazolidin-3-one |
| SMILES | O=C1N(SC(Cl)(Cl)Cl)NC(C2CC2)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11Cl3F3N3OS/c14-13(15,16)24-22-11(23)21(10(20-22)7-4-5-7)9-3-1-2-8(6-9)12(17,18)19/h1-3,6-7,10,20H,4-5H2 |
| InChIKey | YJFCYHXQRRAKTI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|