C19H17Cl3O2 — CID 21276213
2-methyl-2-[(4,5,10-trichloroanthracen-9-yl)methyl]propane-1,3-diol (PubChem CID 21276213) has the molecular formula C19H17Cl3O2 and a molecular weight of 383.70 g/mol. Its IUPAC name is 2-methyl-2-[(4,5,10-trichloroanthracen-9-yl)methyl]propane-1,3-diol.
| Compound Name | 2-methyl-2-[(4,5,10-trichloroanthracen-9-yl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 21276213 |
| Molecular Formula | C19H17Cl3O2 |
| Molecular Weight | 383.70 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2-methyl-2-[(4,5,10-trichloroanthracen-9-yl)methyl]propane-1,3-diol |
| SMILES | CC(CO)(CO)Cc1c2cccc(Cl)c2c(Cl)c2c(Cl)cccc12 |
| InChI | InChI=1S/C19H17Cl3O2/c1-19(9-23,10-24)8-13-11-4-2-6-14(20)16(11)18(22)17-12(13)5-3-7-15(17)21/h2-7,23-24H,8-10H2,1H3 |
| InChIKey | ZHGRUDNRBZAXPZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.70 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|