C18H15NO3 — CID 21276304
4-[(E)-2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid (PubChem CID 21276304) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[(E)-2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 21276304 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 4-[(E)-2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid |
| SMILES | Cc1cc2nc(/C=C/c3ccc(C(=O)O)cc3)oc2cc1C |
| InChI | InChI=1S/C18H15NO3/c1-11-9-15-16(10-12(11)2)22-17(19-15)8-5-13-3-6-14(7-4-13)18(20)21/h3-10H,1-2H3,(H,20,21)/b8-5+ |
| InChIKey | UAPDMWLGZLYJBJ-VMPITWQZSA-N |
| XLogP | 4.31 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |