4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid

C18H15NO3 — CID 54343451

IUPAC4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid
SMILESCc1cc2nc(C=Cc3ccc(C(=O)O)cc3)oc2cc1C
InChIInChI=1S/C18H15NO3/c1-11-9-15-16(10-12(11)2)22-17(19-15)8-5-13-3-6-14(7-4-13)18(20)21/h3-10H,1-2H3,(H,20,21)
InChIKeyUAPDMWLGZLYJBJ-UHFFFAOYSA-N
MW293.32 g/mol
LogP4.31
Rot. Bonds3

About 4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid

4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid (PubChem CID 54343451) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid.

Molecular Properties

Compound Name4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid
PubChem CID54343451
Molecular FormulaC18H15NO3
Molecular Weight293.32 g/mol
Exact Mass293.11
IUPAC Name4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid
SMILESCc1cc2nc(C=Cc3ccc(C(=O)O)cc3)oc2cc1C
InChIInChI=1S/C18H15NO3/c1-11-9-15-16(10-12(11)2)22-17(19-15)8-5-13-3-6-14(7-4-13)18(20)21/h3-10H,1-2H3,(H,20,21)
InChIKeyUAPDMWLGZLYJBJ-UHFFFAOYSA-N
XLogP4.31
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.32
LogP ≤ 54.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid?
The IUPAC name of 4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid (CID 54343451) is 4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid.
What is the SMILES notation for 4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid?
The canonical SMILES for 4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid is Cc1cc2nc(C=Cc3ccc(C(=O)O)cc3)oc2cc1C.
What is the InChIKey of 4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid?
The InChIKey is UAPDMWLGZLYJBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO3/c1-11-9-15-16(10-12(11)2)22-17(19-15)8-5-13-3-6-14(7-4-13)18(20)21/h3-10H,1-2H3,(H,20,21).
What are the key properties of 4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid?
4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid has a molecular weight of 293.32 g/mol, XLogP of 4.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(5,6-dimethyl-1,3-benzoxazol-2-yl)ethenyl]benzoic acid is sourced from PubChem (CID 54343451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).