C29H28F3NO3 — CID 21280483
1-[3-(quinolin-2-ylmethoxy)phenyl]-6-[3-(trifluoromethyl)phenoxy]hexan-1-ol (PubChem CID 21280483) has the molecular formula C29H28F3NO3 and a molecular weight of 495.54 g/mol. Its IUPAC name is 1-[3-(quinolin-2-ylmethoxy)phenyl]-6-[3-(trifluoromethyl)phenoxy]hexan-1-ol.
| Compound Name | 1-[3-(quinolin-2-ylmethoxy)phenyl]-6-[3-(trifluoromethyl)phenoxy]hexan-1-ol |
|---|---|
| PubChem CID | 21280483 |
| Molecular Formula | C29H28F3NO3 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 1-[3-(quinolin-2-ylmethoxy)phenyl]-6-[3-(trifluoromethyl)phenoxy]hexan-1-ol |
| SMILES | OC(CCCCCOc1cccc(C(F)(F)F)c1)c1cccc(OCc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C29H28F3NO3/c30-29(31,32)23-10-7-12-26(19-23)35-17-5-1-2-14-28(34)22-9-6-11-25(18-22)36-20-24-16-15-21-8-3-4-13-27(21)33-24/h3-4,6-13,15-16,18-19,28,34H,1-2,5,14,17,20H2 |
| InChIKey | MASLPYINFXJMPM-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|