C22H25NO3 — CID 21280540
1-[3-(quinolin-2-ylmethoxy)phenyl]hexane-1,2-diol (PubChem CID 21280540) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[3-(quinolin-2-ylmethoxy)phenyl]hexane-1,2-diol.
| Compound Name | 1-[3-(quinolin-2-ylmethoxy)phenyl]hexane-1,2-diol |
|---|---|
| PubChem CID | 21280540 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-[3-(quinolin-2-ylmethoxy)phenyl]hexane-1,2-diol |
| SMILES | CCCCC(O)C(O)c1cccc(OCc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C22H25NO3/c1-2-3-11-21(24)22(25)17-8-6-9-19(14-17)26-15-18-13-12-16-7-4-5-10-20(16)23-18/h4-10,12-14,21-22,24-25H,2-3,11,15H2,1H3 |
| InChIKey | BDUMOXBIOZWSAM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |