C20H19N3O4 — CID 21283644
(6-nitro-2-phenylquinolin-4-yl) N,N-diethylcarbamate (PubChem CID 21283644) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is (6-nitro-2-phenylquinolin-4-yl) N,N-diethylcarbamate.
| Compound Name | (6-nitro-2-phenylquinolin-4-yl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 21283644 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (6-nitro-2-phenylquinolin-4-yl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1cc(-c2ccccc2)nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C20H19N3O4/c1-3-22(4-2)20(24)27-19-13-18(14-8-6-5-7-9-14)21-17-11-10-15(23(25)26)12-16(17)19/h5-13H,3-4H2,1-2H3 |
| InChIKey | ZAKUHEUHFMXMAE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|