C7H8N4O4S2 — CID 21284140
2-N-diazo-1-N-methylbenzene-1,2-disulfonamide (PubChem CID 21284140) has the molecular formula C7H8N4O4S2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-N-diazo-1-N-methylbenzene-1,2-disulfonamide.
| Compound Name | 2-N-diazo-1-N-methylbenzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 21284140 |
| Molecular Formula | C7H8N4O4S2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 2-N-diazo-1-N-methylbenzene-1,2-disulfonamide |
| SMILES | CNS(=O)(=O)c1ccccc1S(=O)(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C7H8N4O4S2/c1-9-16(12,13)6-4-2-3-5-7(6)17(14,15)11-10-8/h2-5,9H,1H3 |
| InChIKey | PQBAKDGMWWEAHA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 129.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|