C10H16BrN3O2 — CID 21285496
4-bromo-5-(3-hydroxypropylamino)-2-propan-2-ylpyridazin-3-one (PubChem CID 21285496) has the molecular formula C10H16BrN3O2 and a molecular weight of 290.16 g/mol. Its IUPAC name is 4-bromo-5-(3-hydroxypropylamino)-2-propan-2-ylpyridazin-3-one.
| Compound Name | 4-bromo-5-(3-hydroxypropylamino)-2-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 21285496 |
| Molecular Formula | C10H16BrN3O2 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 4-bromo-5-(3-hydroxypropylamino)-2-propan-2-ylpyridazin-3-one |
| SMILES | CC(C)n1ncc(NCCCO)c(Br)c1=O |
| InChI | InChI=1S/C10H16BrN3O2/c1-7(2)14-10(16)9(11)8(6-13-14)12-4-3-5-15/h6-7,12,15H,3-5H2,1-2H3 |
| InChIKey | UYBCUTMSLBKLPZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|