C16H16N2O2 — CID 21286352
8-[(2-methoxyphenyl)methoxy]-2-methylimidazo[1,2-a]pyridine (PubChem CID 21286352) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 8-[(2-methoxyphenyl)methoxy]-2-methylimidazo[1,2-a]pyridine.
| Compound Name | 8-[(2-methoxyphenyl)methoxy]-2-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 21286352 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 8-[(2-methoxyphenyl)methoxy]-2-methylimidazo[1,2-a]pyridine |
| SMILES | COc1ccccc1COc1cccn2cc(C)nc12 |
| InChI | InChI=1S/C16H16N2O2/c1-12-10-18-9-5-8-15(16(18)17-12)20-11-13-6-3-4-7-14(13)19-2/h3-10H,11H2,1-2H3 |
| InChIKey | QQHPFZVTHKXZNQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |