C12H17N3O — CID 82146556
4-(2-methylimidazo[1,2-a]pyridin-8-yl)oxybutan-1-amine (PubChem CID 82146556) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 4-(2-methylimidazo[1,2-a]pyridin-8-yl)oxybutan-1-amine.
| Compound Name | 4-(2-methylimidazo[1,2-a]pyridin-8-yl)oxybutan-1-amine |
|---|---|
| PubChem CID | 82146556 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 4-(2-methylimidazo[1,2-a]pyridin-8-yl)oxybutan-1-amine |
| SMILES | Cc1cn2cccc(OCCCCN)c2n1 |
| InChI | InChI=1S/C12H17N3O/c1-10-9-15-7-4-5-11(12(15)14-10)16-8-3-2-6-13/h4-5,7,9H,2-3,6,8,13H2,1H3 |
| InChIKey | PTPMIBYXIPWTSF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|