C11H10O4S — CID 21289554
4-[(4-methoxyphenyl)sulfanylmethyl]-1,3-dioxol-2-one (PubChem CID 21289554) has the molecular formula C11H10O4S and a molecular weight of 238.26 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)sulfanylmethyl]-1,3-dioxol-2-one.
| Compound Name | 4-[(4-methoxyphenyl)sulfanylmethyl]-1,3-dioxol-2-one |
|---|---|
| PubChem CID | 21289554 |
| Molecular Formula | C11H10O4S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 4-[(4-methoxyphenyl)sulfanylmethyl]-1,3-dioxol-2-one |
| SMILES | COc1ccc(SCc2coc(=O)o2)cc1 |
| InChI | InChI=1S/C11H10O4S/c1-13-8-2-4-10(5-3-8)16-7-9-6-14-11(12)15-9/h2-6H,7H2,1H3 |
| InChIKey | RHFSAYLDASTOEY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |