About hexafluoroantimony(1-);tetraethylphosphanium
hexafluoroantimony(1-);tetraethylphosphanium (PubChem CID 21290433) has the molecular formula C8H20F6PSb
and a molecular weight of 382.97 g/mol. Its IUPAC name is hexafluoroantimony(1-);tetraethylphosphanium.
Molecular Properties
| Compound Name | hexafluoroantimony(1-);tetraethylphosphanium |
| PubChem CID | 21290433 |
| Molecular Formula | C8H20F6PSb |
| Molecular Weight | 382.97 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | hexafluoroantimony(1-);tetraethylphosphanium |
| SMILES | CC[P+](CC)(CC)CC.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C8H20P.6FH.Sb/c1-5-9(6-2,7-3)8-4;;;;;;;/h5-8H2,1-4H3;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | QOMVRKVSYSLZGM-UHFFFAOYSA-H |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.97 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hexafluoroantimony(1-);tetraethylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoroantimony(1-);tetraethylphosphanium?
The IUPAC name of hexafluoroantimony(1-);tetraethylphosphanium (CID 21290433) is hexafluoroantimony(1-);tetraethylphosphanium.
What is the SMILES notation for hexafluoroantimony(1-);tetraethylphosphanium?
The canonical SMILES for hexafluoroantimony(1-);tetraethylphosphanium is CC[P+](CC)(CC)CC.F[Sb-](F)(F)(F)(F)F.
What is the InChIKey of hexafluoroantimony(1-);tetraethylphosphanium?
The InChIKey is QOMVRKVSYSLZGM-UHFFFAOYSA-H. The full InChI is InChI=1S/C8H20P.6FH.Sb/c1-5-9(6-2,7-3)8-4;;;;;;;/h5-8H2,1-4H3;6*1H;/q+1;;;;;;;+5/p-6.
What are the key properties of hexafluoroantimony(1-);tetraethylphosphanium?
hexafluoroantimony(1-);tetraethylphosphanium has a molecular weight of 382.97 g/mol, XLogP of 5.22, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoroantimony(1-);tetraethylphosphanium is sourced from PubChem (CID 21290433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).