About methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate
methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate (PubChem CID 21292419) has the molecular formula C18H22N3O5-
and a molecular weight of 360.39 g/mol. Its IUPAC name is methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate.
Molecular Properties
| Compound Name | methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate |
| PubChem CID | 21292419 |
| Molecular Formula | C18H22N3O5- |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate |
| SMILES | COC(=O)c1cncn1Cc1ccccc1C1CCCCC1.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C18H22N2O2.NO3/c1-22-18(21)17-11-19-13-20(17)12-15-9-5-6-10-16(15)14-7-3-2-4-8-14;2-1(3)4/h5-6,9-11,13-14H,2-4,7-8,12H2,1H3;/q;-1 |
| InChIKey | JFDHJTWPLNTQLG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 110.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate?
The IUPAC name of methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate (CID 21292419) is methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate.
What is the SMILES notation for methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate?
The canonical SMILES for methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate is COC(=O)c1cncn1Cc1ccccc1C1CCCCC1.O=[N+]([O-])[O-].
What is the InChIKey of methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate?
The InChIKey is JFDHJTWPLNTQLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2.NO3/c1-22-18(21)17-11-19-13-20(17)12-15-9-5-6-10-16(15)14-7-3-2-4-8-14;2-1(3)4/h5-6,9-11,13-14H,2-4,7-8,12H2,1H3;/q;-1.
What are the key properties of methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate?
methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate has a molecular weight of 360.39 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2-cyclohexylphenyl)methyl]imidazole-4-carboxylate nitrate is sourced from PubChem (CID 21292419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).