C28H36N2O2 — CID 21292688
1-[2-methoxy-4-[1-(3-methoxy-4-piperidin-1-ylphenyl)buta-1,3-dienyl]phenyl]piperidine (PubChem CID 21292688) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 1-[2-methoxy-4-[1-(3-methoxy-4-piperidin-1-ylphenyl)buta-1,3-dienyl]phenyl]piperidine.
| Compound Name | 1-[2-methoxy-4-[1-(3-methoxy-4-piperidin-1-ylphenyl)buta-1,3-dienyl]phenyl]piperidine |
|---|---|
| PubChem CID | 21292688 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 1-[2-methoxy-4-[1-(3-methoxy-4-piperidin-1-ylphenyl)buta-1,3-dienyl]phenyl]piperidine |
| SMILES | C=CC=C(c1ccc(N2CCCCC2)c(OC)c1)c1ccc(N2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C28H36N2O2/c1-4-11-24(22-12-14-25(27(20-22)31-2)29-16-7-5-8-17-29)23-13-15-26(28(21-23)32-3)30-18-9-6-10-19-30/h4,11-15,20-21H,1,5-10,16-19H2,2-3H3 |
| InChIKey | XTUPWFRDXNZAEY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|