C24H24N4O2S — CID 21293982
1-[2-(1H-indol-3-yl)ethylamino]-3-[2-(1H-thieno[3,2-c]pyrazol-3-yl)phenoxy]propan-2-ol (PubChem CID 21293982) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethylamino]-3-[2-(1H-thieno[3,2-c]pyrazol-3-yl)phenoxy]propan-2-ol.
| Compound Name | 1-[2-(1H-indol-3-yl)ethylamino]-3-[2-(1H-thieno[3,2-c]pyrazol-3-yl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 21293982 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethylamino]-3-[2-(1H-thieno[3,2-c]pyrazol-3-yl)phenoxy]propan-2-ol |
| SMILES | OC(CNCCc1c[nH]c2ccccc12)COc1ccccc1-c1n[nH]c2ccsc12 |
| InChI | InChI=1S/C24H24N4O2S/c29-17(14-25-11-9-16-13-26-20-7-3-1-5-18(16)20)15-30-22-8-4-2-6-19(22)23-24-21(27-28-23)10-12-31-24/h1-8,10,12-13,17,25-26,29H,9,11,14-15H2,(H,27,28) |
| InChIKey | JRCXEHDPJZGABK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|