C15H17N3S — CID 66387708
2-[[2-(1H-indol-3-yl)ethylamino]methyl]thiophen-3-amine (PubChem CID 66387708) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 2-[[2-(1H-indol-3-yl)ethylamino]methyl]thiophen-3-amine.
| Compound Name | 2-[[2-(1H-indol-3-yl)ethylamino]methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66387708 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-[[2-(1H-indol-3-yl)ethylamino]methyl]thiophen-3-amine |
| SMILES | Nc1ccsc1CNCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H17N3S/c16-13-6-8-19-15(13)10-17-7-5-11-9-18-14-4-2-1-3-12(11)14/h1-4,6,8-9,17-18H,5,7,10,16H2 |
| InChIKey | OZFMGMUQKOVISY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|