C13H16N4O2S — CID 21295412
3-[[1-(4-ethylphenyl)tetrazol-5-yl]methylsulfanyl]propanoic acid (PubChem CID 21295412) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-[[1-(4-ethylphenyl)tetrazol-5-yl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[1-(4-ethylphenyl)tetrazol-5-yl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 21295412 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-[[1-(4-ethylphenyl)tetrazol-5-yl]methylsulfanyl]propanoic acid |
| SMILES | CCc1ccc(-n2nnnc2CSCCC(=O)O)cc1 |
| InChI | InChI=1S/C13H16N4O2S/c1-2-10-3-5-11(6-4-10)17-12(14-15-16-17)9-20-8-7-13(18)19/h3-6H,2,7-9H2,1H3,(H,18,19) |
| InChIKey | PNYMWKMPJPAFLN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|