C17H19N5OS2 — CID 87046366
N-[(5-ethylthiophen-2-yl)methyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]acetamide (PubChem CID 87046366) has the molecular formula C17H19N5OS2 and a molecular weight of 373.51 g/mol. Its IUPAC name is N-[(5-ethylthiophen-2-yl)methyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]acetamide.
| Compound Name | N-[(5-ethylthiophen-2-yl)methyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 87046366 |
| Molecular Formula | C17H19N5OS2 |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[(5-ethylthiophen-2-yl)methyl]-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]acetamide |
| SMILES | CCc1ccc(CNC(=O)CSCc2nnnn2-c2ccccc2)s1 |
| InChI | InChI=1S/C17H19N5OS2/c1-2-14-8-9-15(25-14)10-18-17(23)12-24-11-16-19-20-21-22(16)13-6-4-3-5-7-13/h3-9H,2,10-12H2,1H3,(H,18,23) |
| InChIKey | QECSQYIRUJIIRH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |