C17H24FN3O2 — CID 21295689
2-(3,3-dimethyl-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-7-yl)-N-(5-fluoro-2-methylphenyl)acetamide (PubChem CID 21295689) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-(3,3-dimethyl-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-7-yl)-N-(5-fluoro-2-methylphenyl)acetamide.
| Compound Name | 2-(3,3-dimethyl-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-7-yl)-N-(5-fluoro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 21295689 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2-(3,3-dimethyl-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-7-yl)-N-(5-fluoro-2-methylphenyl)acetamide |
| SMILES | Cc1ccc(F)cc1NC(=O)CN1CCN2C(COC2(C)C)C1 |
| InChI | InChI=1S/C17H24FN3O2/c1-12-4-5-13(18)8-15(12)19-16(22)10-20-6-7-21-14(9-20)11-23-17(21,2)3/h4-5,8,14H,6-7,9-11H2,1-3H3,(H,19,22) |
| InChIKey | JMQGXDAAZNTETE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |