C14H30Cl2P2 — CID 21297157
(1,1-dichloro-1-diethylphosphanylhexan-2-yl)-diethylphosphane (PubChem CID 21297157) has the molecular formula C14H30Cl2P2 and a molecular weight of 331.25 g/mol. Its IUPAC name is (1,1-dichloro-1-diethylphosphanylhexan-2-yl)-diethylphosphane.
| Compound Name | (1,1-dichloro-1-diethylphosphanylhexan-2-yl)-diethylphosphane |
|---|---|
| PubChem CID | 21297157 |
| Molecular Formula | C14H30Cl2P2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (1,1-dichloro-1-diethylphosphanylhexan-2-yl)-diethylphosphane |
| SMILES | CCCCC(P(CC)CC)C(Cl)(Cl)P(CC)CC |
| InChI | InChI=1S/C14H30Cl2P2/c1-6-11-12-13(17(7-2)8-3)14(15,16)18(9-4)10-5/h13H,6-12H2,1-5H3 |
| InChIKey | DHNRCNHWMYBXTJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|