C11H22NO5P — CID 21299180
2-amino-2-[4-(phosphonomethyl)cyclohexyl]butanoic acid (PubChem CID 21299180) has the molecular formula C11H22NO5P and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-amino-2-[4-(phosphonomethyl)cyclohexyl]butanoic acid.
| Compound Name | 2-amino-2-[4-(phosphonomethyl)cyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 21299180 |
| Molecular Formula | C11H22NO5P |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-amino-2-[4-(phosphonomethyl)cyclohexyl]butanoic acid |
| SMILES | CCC(N)(C(=O)O)C1CCC(CP(=O)(O)O)CC1 |
| InChI | InChI=1S/C11H22NO5P/c1-2-11(12,10(13)14)9-5-3-8(4-6-9)7-18(15,16)17/h8-9H,2-7,12H2,1H3,(H,13,14)(H2,15,16,17) |
| InChIKey | LNEASMYDEHHFMC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|