About methyl 3-acetamido-2,2,3-trimethylbutanoate
methyl 3-acetamido-2,2,3-trimethylbutanoate (PubChem CID 21299733) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is methyl 3-acetamido-2,2,3-trimethylbutanoate.
Molecular Properties
| Compound Name | methyl 3-acetamido-2,2,3-trimethylbutanoate |
| PubChem CID | 21299733 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | methyl 3-acetamido-2,2,3-trimethylbutanoate |
| SMILES | COC(=O)C(C)(C)C(C)(C)NC(C)=O |
| InChI | InChI=1S/C10H19NO3/c1-7(12)11-10(4,5)9(2,3)8(13)14-6/h1-6H3,(H,11,12) |
| InChIKey | VDROQSBGDCVUPX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-acetamido-2,2,3-trimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-acetamido-2,2,3-trimethylbutanoate?
The IUPAC name of methyl 3-acetamido-2,2,3-trimethylbutanoate (CID 21299733) is methyl 3-acetamido-2,2,3-trimethylbutanoate.
What is the SMILES notation for methyl 3-acetamido-2,2,3-trimethylbutanoate?
The canonical SMILES for methyl 3-acetamido-2,2,3-trimethylbutanoate is COC(=O)C(C)(C)C(C)(C)NC(C)=O.
What is the InChIKey of methyl 3-acetamido-2,2,3-trimethylbutanoate?
The InChIKey is VDROQSBGDCVUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-7(12)11-10(4,5)9(2,3)8(13)14-6/h1-6H3,(H,11,12).
What are the key properties of methyl 3-acetamido-2,2,3-trimethylbutanoate?
methyl 3-acetamido-2,2,3-trimethylbutanoate has a molecular weight of 201.27 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-acetamido-2,2,3-trimethylbutanoate is sourced from PubChem (CID 21299733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).