C13H18FNO9 — CID 131859102
tetramethyl 1-acetamido-3-fluoropropane-1,1,3,3-tetracarboxylate (PubChem CID 131859102) has the molecular formula C13H18FNO9 and a molecular weight of 351.28 g/mol. Its IUPAC name is tetramethyl 1-acetamido-3-fluoropropane-1,1,3,3-tetracarboxylate.
| Compound Name | tetramethyl 1-acetamido-3-fluoropropane-1,1,3,3-tetracarboxylate |
|---|---|
| PubChem CID | 131859102 |
| Molecular Formula | C13H18FNO9 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | tetramethyl 1-acetamido-3-fluoropropane-1,1,3,3-tetracarboxylate |
| SMILES | COC(=O)C(F)(CC(NC(C)=O)(C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H18FNO9/c1-7(16)15-13(10(19)23-4,11(20)24-5)6-12(14,8(17)21-2)9(18)22-3/h6H2,1-5H3,(H,15,16) |
| InChIKey | CSVYGLHJRLEMOJ-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|