C33H29N3OS — CID 21301871
2-[1-(4-methoxyphenyl)-2-(4-piperidin-1-ylphenyl)indol-3-yl]-1,3-benzothiazole (PubChem CID 21301871) has the molecular formula C33H29N3OS and a molecular weight of 515.68 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)-2-(4-piperidin-1-ylphenyl)indol-3-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(4-methoxyphenyl)-2-(4-piperidin-1-ylphenyl)indol-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 21301871 |
| Molecular Formula | C33H29N3OS |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)-2-(4-piperidin-1-ylphenyl)indol-3-yl]-1,3-benzothiazole |
| SMILES | COc1ccc(-n2c(-c3ccc(N4CCCCC4)cc3)c(-c3nc4ccccc4s3)c3ccccc32)cc1 |
| InChI | InChI=1S/C33H29N3OS/c1-37-26-19-17-25(18-20-26)36-29-11-5-3-9-27(29)31(33-34-28-10-4-6-12-30(28)38-33)32(36)23-13-15-24(16-14-23)35-21-7-2-8-22-35/h3-6,9-20H,2,7-8,21-22H2,1H3 |
| InChIKey | FCVVZGBTJGBYLI-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|