C34H27N3OS — CID 21301872
2-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-1-(4-methoxyphenyl)indol-3-yl]-1,3-benzothiazole (PubChem CID 21301872) has the molecular formula C34H27N3OS and a molecular weight of 525.68 g/mol. Its IUPAC name is 2-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-1-(4-methoxyphenyl)indol-3-yl]-1,3-benzothiazole.
| Compound Name | 2-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-1-(4-methoxyphenyl)indol-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 21301872 |
| Molecular Formula | C34H27N3OS |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 2-[2-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-1-(4-methoxyphenyl)indol-3-yl]-1,3-benzothiazole |
| SMILES | COc1ccc(-n2c(-c3ccc(-n4c(C)ccc4C)cc3)c(-c3nc4ccccc4s3)c3ccccc32)cc1 |
| InChI | InChI=1S/C34H27N3OS/c1-22-12-13-23(2)36(22)25-16-14-24(15-17-25)33-32(34-35-29-9-5-7-11-31(29)39-34)28-8-4-6-10-30(28)37(33)26-18-20-27(38-3)21-19-26/h4-21H,1-3H3 |
| InChIKey | GBRHTFHOQYSHBE-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|