2,6-difluoro-5-methylpyridine-3-carboxylic acid

C7H5F2NO2 — CID 21303212

IUPAC2,6-difluoro-5-methylpyridine-3-carboxylic acid
SMILESCc1cc(C(=O)O)c(F)nc1F
InChIInChI=1S/C7H5F2NO2/c1-3-2-4(7(11)12)6(9)10-5(3)8/h2H,1H3,(H,11,12)
InChIKeyPMXLKOJGGOCYII-UHFFFAOYSA-N
MW173.12 g/mol
LogP1.37
Rot. Bonds1

About 2,6-difluoro-5-methylpyridine-3-carboxylic acid

2,6-difluoro-5-methylpyridine-3-carboxylic acid (PubChem CID 21303212) has the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. Its IUPAC name is 2,6-difluoro-5-methylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name2,6-difluoro-5-methylpyridine-3-carboxylic acid
PubChem CID21303212
Molecular FormulaC7H5F2NO2
Molecular Weight173.12 g/mol
Exact Mass173.03
IUPAC Name2,6-difluoro-5-methylpyridine-3-carboxylic acid
SMILESCc1cc(C(=O)O)c(F)nc1F
InChIInChI=1S/C7H5F2NO2/c1-3-2-4(7(11)12)6(9)10-5(3)8/h2H,1H3,(H,11,12)
InChIKeyPMXLKOJGGOCYII-UHFFFAOYSA-N
XLogP1.37
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.12
LogP ≤ 51.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 2,6-difluoro-5-methylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-difluoro-5-methylpyridine-3-carboxylic acid?
The IUPAC name of 2,6-difluoro-5-methylpyridine-3-carboxylic acid (CID 21303212) is 2,6-difluoro-5-methylpyridine-3-carboxylic acid.
What is the SMILES notation for 2,6-difluoro-5-methylpyridine-3-carboxylic acid?
The canonical SMILES for 2,6-difluoro-5-methylpyridine-3-carboxylic acid is Cc1cc(C(=O)O)c(F)nc1F.
What is the InChIKey of 2,6-difluoro-5-methylpyridine-3-carboxylic acid?
The InChIKey is PMXLKOJGGOCYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F2NO2/c1-3-2-4(7(11)12)6(9)10-5(3)8/h2H,1H3,(H,11,12).
What are the key properties of 2,6-difluoro-5-methylpyridine-3-carboxylic acid?
2,6-difluoro-5-methylpyridine-3-carboxylic acid has a molecular weight of 173.12 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-5-methylpyridine-3-carboxylic acid is sourced from PubChem (CID 21303212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).