About actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide
actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide (PubChem CID 21303271) has the molecular formula C15H23AcN2-
and a molecular weight of 458.36 g/mol. Its IUPAC name is actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide.
Molecular Properties
| Compound Name | actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide |
| PubChem CID | 21303271 |
| Molecular Formula | C15H23AcN2- |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide |
| SMILES | CC(C)N1CCC(C[NH-])(c2ccccc2)CC1.[Ac] |
| InChI | InChI=1S/C15H23N2.Ac/c1-13(2)17-10-8-15(12-16,9-11-17)14-6-4-3-5-7-14;/h3-7,13,16H,8-12H2,1-2H3;/q-1; |
| InChIKey | PTCRVZRMLJPQSH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 27.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide?
The IUPAC name of actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide (CID 21303271) is actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide.
What is the SMILES notation for actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide?
The canonical SMILES for actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide is CC(C)N1CCC(C[NH-])(c2ccccc2)CC1.[Ac].
What is the InChIKey of actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide?
The InChIKey is PTCRVZRMLJPQSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N2.Ac/c1-13(2)17-10-8-15(12-16,9-11-17)14-6-4-3-5-7-14;/h3-7,13,16H,8-12H2,1-2H3;/q-1;.
What are the key properties of actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide?
actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide has a molecular weight of 458.36 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;(4-phenyl-1-propan-2-ylpiperidin-4-yl)methylazanide is sourced from PubChem (CID 21303271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).