C14H22N2O5S — CID 21307419
6-methylsulfanylhexyl 2-(3-methyl-2,4,6-trioxo-1,3-diazinan-1-yl)acetate (PubChem CID 21307419) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is 6-methylsulfanylhexyl 2-(3-methyl-2,4,6-trioxo-1,3-diazinan-1-yl)acetate.
| Compound Name | 6-methylsulfanylhexyl 2-(3-methyl-2,4,6-trioxo-1,3-diazinan-1-yl)acetate |
|---|---|
| PubChem CID | 21307419 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 6-methylsulfanylhexyl 2-(3-methyl-2,4,6-trioxo-1,3-diazinan-1-yl)acetate |
| SMILES | CSCCCCCCOC(=O)CN1C(=O)CC(=O)N(C)C1=O |
| InChI | InChI=1S/C14H22N2O5S/c1-15-11(17)9-12(18)16(14(15)20)10-13(19)21-7-5-3-4-6-8-22-2/h3-10H2,1-2H3 |
| InChIKey | QAECAQHQAQIBLQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|