C21H35N3O17P2S — CID 21308174
(6S,7S)-7-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoylamino]-3-(carbamoyloxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 21308174) has the molecular formula C21H35N3O17P2S and a molecular weight of 695.53 g/mol. Its IUPAC name is (6S,7S)-7-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoylamino]-3-(carbamoyloxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7S)-7-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoylamino]-3-(carbamoyloxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 21308174 |
| Molecular Formula | C21H35N3O17P2S |
| Molecular Weight | 695.53 g/mol |
| Exact Mass | 695.12 |
| IUPAC Name | (6S,7S)-7-[3,3-bis[bis(ethylperoxy)phosphoryl]propanoylamino]-3-(carbamoyloxymethyl)-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCOOP(=O)(OOCC)C(CC(=O)N[C@]1(OC)C(=O)N2C(C(=O)O)=C(COC(N)=O)CS[C@H]21)P(=O)(OOCC)OOCC |
| InChI | InChI=1S/C21H35N3O17P2S/c1-6-34-38-42(30,39-35-7-2)15(43(31,40-36-8-3)41-37-9-4)10-14(25)23-21(32-5)18(28)24-16(17(26)27)13(11-33-20(22)29)12-44-19(21)24/h15,19H,6-12H2,1-5H3,(H2,22,29)(H,23,25)(H,26,27)/t19-,21-/m0/s1 |
| InChIKey | BSSKSNVMHPXQMS-FPOVZHCZSA-N |
| XLogP | 1.77 |
| TPSA | 256.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|