C16H18N2O7S2 — CID 88818149
(6R,7S)-3-(acetyloxymethyl)-7-methoxy-8-oxo-7-[(2-prop-2-ynylsulfanylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88818149) has the molecular formula C16H18N2O7S2 and a molecular weight of 414.46 g/mol. Its IUPAC name is (6R,7S)-3-(acetyloxymethyl)-7-methoxy-8-oxo-7-[(2-prop-2-ynylsulfanylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-3-(acetyloxymethyl)-7-methoxy-8-oxo-7-[(2-prop-2-ynylsulfanylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88818149 |
| Molecular Formula | C16H18N2O7S2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | (6R,7S)-3-(acetyloxymethyl)-7-methoxy-8-oxo-7-[(2-prop-2-ynylsulfanylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C#CCSCC(=O)N[C@]1(OC)C(=O)N2C(C(=O)O)=C(COC(C)=O)CS[C@@H]21 |
| InChI | InChI=1S/C16H18N2O7S2/c1-4-5-26-8-11(20)17-16(24-3)14(23)18-12(13(21)22)10(6-25-9(2)19)7-27-15(16)18/h1,15H,5-8H2,2-3H3,(H,17,20)(H,21,22)/t15-,16+/m1/s1 |
| InChIKey | WCIAMMWECQKFQN-CVEARBPZSA-N |
| XLogP | -0.37 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|