C17H16N2O8S3 — CID 88776277
(6R,7S)-3-(acetyloxymethyl)-7-methoxy-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88776277) has the molecular formula C17H16N2O8S3 and a molecular weight of 472.52 g/mol. Its IUPAC name is (6R,7S)-3-(acetyloxymethyl)-7-methoxy-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-3-(acetyloxymethyl)-7-methoxy-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88776277 |
| Molecular Formula | C17H16N2O8S3 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | (6R,7S)-3-(acetyloxymethyl)-7-methoxy-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@@]1(NC(=O)C(=S=O)c2cccs2)C(=O)N2C(C(=O)O)=C(COC(C)=O)CS[C@@H]21 |
| InChI | InChI=1S/C17H16N2O8S3/c1-8(20)27-6-9-7-29-16-17(26-2,15(24)19(16)11(9)14(22)23)18-13(21)12(30-25)10-4-3-5-28-10/h3-5,16H,6-7H2,1-2H3,(H,18,21)(H,22,23)/t16-,17+/m1/s1 |
| InChIKey | NZHOZHODRXVLRS-SJORKVTESA-N |
| XLogP | -0.24 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|