C17H16N6O6S4 — CID 88776186
(6R,7S)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88776186) has the molecular formula C17H16N6O6S4 and a molecular weight of 528.62 g/mol. Its IUPAC name is (6R,7S)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88776186 |
| Molecular Formula | C17H16N6O6S4 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | (6R,7S)-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-7-[(2-sulfinyl-2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@@]1(NC(=O)C(=S=O)c2cccs2)C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@@H]21 |
| InChI | InChI=1S/C17H16N6O6S4/c1-22-16(19-20-21-22)32-7-8-6-31-15-17(29-2,14(27)23(15)10(8)13(25)26)18-12(24)11(33-28)9-4-3-5-30-9/h3-5,15H,6-7H2,1-2H3,(H,18,24)(H,25,26)/t15-,17+/m1/s1 |
| InChIKey | YVIPUPXLWSUIIR-WBVHZDCISA-N |
| XLogP | -0.49 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|