C15H17BrN6O6S2 — CID 56975691
(6S,7S)-7-[(4-bromo-3-oxobutanoyl)amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 56975691) has the molecular formula C15H17BrN6O6S2 and a molecular weight of 521.38 g/mol. Its IUPAC name is (6S,7S)-7-[(4-bromo-3-oxobutanoyl)amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7S)-7-[(4-bromo-3-oxobutanoyl)amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56975691 |
| Molecular Formula | C15H17BrN6O6S2 |
| Molecular Weight | 521.38 g/mol |
| Exact Mass | 519.98 |
| IUPAC Name | (6S,7S)-7-[(4-bromo-3-oxobutanoyl)amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@@]1(NC(=O)CC(=O)CBr)C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@H]21 |
| InChI | InChI=1S/C15H17BrN6O6S2/c1-21-14(18-19-20-21)30-6-7-5-29-13-15(28-2,17-9(24)3-8(23)4-16)12(27)22(13)10(7)11(25)26/h13H,3-6H2,1-2H3,(H,17,24)(H,25,26)/t13-,15-/m0/s1 |
| InChIKey | AJIRYQWLZKWQHD-ZFWWWQNUSA-N |
| XLogP | -0.63 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.38 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|